C20H29FN2O — CID 137359795
(1R,9R,10S)-N-(2-fluoroethyl)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-amine (PubChem CID 137359795) has the molecular formula C20H29FN2O and a molecular weight of 332.46 g/mol. Its IUPAC name is (1R,9R,10S)-N-(2-fluoroethyl)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-amine.
| Compound Name | (1R,9R,10S)-N-(2-fluoroethyl)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-amine |
|---|---|
| PubChem CID | 137359795 |
| Molecular Formula | C20H29FN2O |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | (1R,9R,10S)-N-(2-fluoroethyl)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-amine |
| SMILES | COc1cc2c(cc1NCCF)C[C@@H]1[C@H]3CCCC[C@]23CCN1C |
| InChI | InChI=1S/C20H29FN2O/c1-23-10-7-20-6-4-3-5-15(20)18(23)12-14-11-17(22-9-8-21)19(24-2)13-16(14)20/h11,13,15,18,22H,3-10,12H2,1-2H3/t15-,18-,20-/m1/s1 |
| InChIKey | IMTJFAJDVPHYPN-XFQXTVEOSA-N |
| XLogP | 3.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |