C26H27F6NO — CID 177454793
(1R,9R,10S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene (PubChem CID 177454793) has the molecular formula C26H27F6NO and a molecular weight of 483.50 g/mol. Its IUPAC name is (1R,9R,10S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene.
| Compound Name | (1R,9R,10S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene |
|---|---|
| PubChem CID | 177454793 |
| Molecular Formula | C26H27F6NO |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (1R,9R,10S)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene |
| SMILES | COc1cc2c(cc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C[C@@H]1[C@H]3CCCC[C@]23CCN1C |
| InChI | InChI=1S/C26H27F6NO/c1-33-8-7-24-6-4-3-5-20(24)22(33)12-16-11-19(23(34-2)14-21(16)24)15-9-17(25(27,28)29)13-18(10-15)26(30,31)32/h9-11,13-14,20,22H,3-8,12H2,1-2H3/t20-,22-,24-/m1/s1 |
| InChIKey | QQORVRDRXWLEKZ-KIFXHHALSA-N |
| XLogP | 7.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |