C24H37N3O — CID 175946703
1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 175946703) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is 1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 175946703 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | 1-[(1S,9S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | COc1cc2c(cc1N1CCC(N(C)C)C1)C[C@H]1C3CCCC[C@@]23CCN1C |
| InChI | InChI=1S/C24H37N3O/c1-25(2)18-8-11-27(16-18)22-14-17-13-21-19-7-5-6-9-24(19,10-12-26(21)3)20(17)15-23(22)28-4/h14-15,18-19,21H,5-13,16H2,1-4H3/t18?,19?,21-,24-/m0/s1 |
| InChIKey | RUQSOHFMHXWNTJ-WPOXWQNPSA-N |
| XLogP | 3.52 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |