C19H27FN2O — CID 129195166
(1S,9S,10S)-5-(2-fluoroethylamino)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 129195166) has the molecular formula C19H27FN2O and a molecular weight of 318.44 g/mol. Its IUPAC name is (1S,9S,10S)-5-(2-fluoroethylamino)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1S,9S,10S)-5-(2-fluoroethylamino)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 129195166 |
| Molecular Formula | C19H27FN2O |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (1S,9S,10S)-5-(2-fluoroethylamino)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc1cc(NCCF)c(O)cc13 |
| InChI | InChI=1S/C19H27FN2O/c1-22-9-6-19-5-3-2-4-14(19)17(22)11-13-10-16(21-8-7-20)18(23)12-15(13)19/h10,12,14,17,21,23H,2-9,11H2,1H3/t14-,17+,19+/m1/s1 |
| InChIKey | NMUYXXYSVFWAGS-LJHODMEESA-N |
| XLogP | 3.46 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|