C20H30ClN3O — CID 145186929
N-[2-amino-5-(1,2-dimethyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)-4-methylphenyl]-2-chloroacetamide (PubChem CID 145186929) has the molecular formula C20H30ClN3O and a molecular weight of 363.93 g/mol. Its IUPAC name is N-[2-amino-5-(1,2-dimethyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)-4-methylphenyl]-2-chloroacetamide.
| Compound Name | N-[2-amino-5-(1,2-dimethyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)-4-methylphenyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 145186929 |
| Molecular Formula | C20H30ClN3O |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-[2-amino-5-(1,2-dimethyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl)-4-methylphenyl]-2-chloroacetamide |
| SMILES | Cc1cc(N)c(NC(=O)CCl)cc1C12CCCCC1C(C)N(C)CC2 |
| InChI | InChI=1S/C20H30ClN3O/c1-13-10-17(22)18(23-19(25)12-21)11-16(13)20-7-5-4-6-15(20)14(2)24(3)9-8-20/h10-11,14-15H,4-9,12,22H2,1-3H3,(H,23,25) |
| InChIKey | NHBYOYMHLFNFJK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|