C21H28F3NO4S — CID 145186932
[4-methyl-3-[1-methyl-2-(oxetan-3-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] trifluoromethanesulfonate (PubChem CID 145186932) has the molecular formula C21H28F3NO4S and a molecular weight of 447.52 g/mol. Its IUPAC name is [4-methyl-3-[1-methyl-2-(oxetan-3-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-methyl-3-[1-methyl-2-(oxetan-3-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145186932 |
| Molecular Formula | C21H28F3NO4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [4-methyl-3-[1-methyl-2-(oxetan-3-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1C12CCCCC1C(C)N(C1COC1)CC2 |
| InChI | InChI=1S/C21H28F3NO4S/c1-14-6-7-17(29-30(26,27)21(22,23)24)11-19(14)20-8-4-3-5-18(20)15(2)25(10-9-20)16-12-28-13-16/h6-7,11,15-16,18H,3-5,8-10,12-13H2,1-2H3 |
| InChIKey | RPJUTZPHCABFLN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|