C19H24F3NO — CID 166958074
(1S,9S,10R)-17-methyl-4-(trifluoromethoxy)-17-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-triene (PubChem CID 166958074) has the molecular formula C19H24F3NO and a molecular weight of 339.40 g/mol. Its IUPAC name is (1S,9S,10R)-17-methyl-4-(trifluoromethoxy)-17-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-triene.
| Compound Name | (1S,9S,10R)-17-methyl-4-(trifluoromethoxy)-17-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 166958074 |
| Molecular Formula | C19H24F3NO |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (1S,9S,10R)-17-methyl-4-(trifluoromethoxy)-17-azatetracyclo[7.5.4.01,10.02,7]octadeca-2(7),3,5-triene |
| SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@H](Cc2ccc(OC(F)(F)F)cc23)C1 |
| InChI | InChI=1S/C19H24F3NO/c1-23-9-8-18-7-3-2-4-16(18)14(12-23)10-13-5-6-15(11-17(13)18)24-19(20,21)22/h5-6,11,14,16H,2-4,7-10,12H2,1H3/t14-,16-,18+/m1/s1 |
| InChIKey | ZHTCOYYDKAERLS-KYJSFNMBSA-N |
| XLogP | 4.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |