C17H22F3NO4S — CID 102234491
[2-[(3aR,7aR)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-6-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 102234491) has the molecular formula C17H22F3NO4S and a molecular weight of 393.43 g/mol. Its IUPAC name is [2-[(3aR,7aR)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-6-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [2-[(3aR,7aR)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-6-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102234491 |
| Molecular Formula | C17H22F3NO4S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [2-[(3aR,7aR)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-6-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1cccc([C@]23CCCC[C@H]2N(C)CC3)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO4S/c1-21-11-10-16(9-4-3-8-14(16)21)12-6-5-7-13(24-2)15(12)25-26(22,23)17(18,19)20/h5-7,14H,3-4,8-11H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | BIBHXOFMAMCJDJ-GDBMZVCRSA-N |
| XLogP | 3.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|