C17H25NO2 — CID 10989483
(3aR,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 10989483) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (3aR,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 10989483 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (3aR,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | COc1ccc([C@]23CCCC[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C17H25NO2/c1-18-11-10-17(9-5-4-6-16(17)18)13-7-8-14(19-2)15(12-13)20-3/h7-8,12,16H,4-6,9-11H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | GBPVTGHCALDTNY-IAGOWNOFSA-N |
| XLogP | 3.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |