C17H24ClNO3 — CID 22210568
3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one;hydrochloride (PubChem CID 22210568) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one;hydrochloride.
| Compound Name | 3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one;hydrochloride |
|---|---|
| PubChem CID | 22210568 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one;hydrochloride |
| SMILES | COc1ccc(C23CCC(=O)CC2N(C)CC3)cc1OC.Cl |
| InChI | InChI=1S/C17H23NO3.ClH/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3;/h4-5,10,16H,6-9,11H2,1-3H3;1H |
| InChIKey | AWTUIVVWCZGIAQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |