C18H25NO3 — CID 102464596
4a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-quinolin-7-one (PubChem CID 102464596) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 4a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-quinolin-7-one.
| Compound Name | 4a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-quinolin-7-one |
|---|---|
| PubChem CID | 102464596 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 4a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-quinolin-7-one |
| SMILES | COc1ccc(C23CCCN(C)C2CC(=O)CC3)cc1OC |
| InChI | InChI=1S/C18H25NO3/c1-19-10-4-8-18(9-7-14(20)12-17(18)19)13-5-6-15(21-2)16(11-13)22-3/h5-6,11,17H,4,7-10,12H2,1-3H3 |
| InChIKey | WRLKEFRFNBGZLB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |