C17H21F2NO3 — CID 90901794
(3aS,7aR)-3a-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one (PubChem CID 90901794) has the molecular formula C17H21F2NO3 and a molecular weight of 325.36 g/mol. Its IUPAC name is (3aS,7aR)-3a-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one.
| Compound Name | (3aS,7aR)-3a-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one |
|---|---|
| PubChem CID | 90901794 |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (3aS,7aR)-3a-[4-(difluoromethoxy)-3-methoxyphenyl]-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one |
| SMILES | COc1cc([C@@]23CCC(=O)C[C@H]2N(C)CC3)ccc1OC(F)F |
| InChI | InChI=1S/C17H21F2NO3/c1-20-8-7-17(6-5-12(21)10-15(17)20)11-3-4-13(23-16(18)19)14(9-11)22-2/h3-4,9,15-16H,5-8,10H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | ZDGBAYXCRZZJRO-WBVHZDCISA-N |
| XLogP | 2.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |