C20H29NO3 — CID 176509980
(3aS,7aS)-3a-(3-butoxy-4-methoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one (PubChem CID 176509980) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (3aS,7aS)-3a-(3-butoxy-4-methoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one.
| Compound Name | (3aS,7aS)-3a-(3-butoxy-4-methoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one |
|---|---|
| PubChem CID | 176509980 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (3aS,7aS)-3a-(3-butoxy-4-methoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-one |
| SMILES | CCCCOc1cc([C@@]23CCC(=O)C[C@@H]2N(C)CC3)ccc1OC |
| InChI | InChI=1S/C20H29NO3/c1-4-5-12-24-18-13-15(6-7-17(18)23-3)20-9-8-16(22)14-19(20)21(2)11-10-20/h6-7,13,19H,4-5,8-12,14H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | MOQSMUONBKSVIT-PMACEKPBSA-N |
| XLogP | 3.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|