C22H36N4O2 — CID 91289453
1-[(3aS,6R,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-2-butylguanidine (PubChem CID 91289453) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-[(3aS,6R,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-2-butylguanidine.
| Compound Name | 1-[(3aS,6R,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-2-butylguanidine |
|---|---|
| PubChem CID | 91289453 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 1-[(3aS,6R,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-2-butylguanidine |
| SMILES | CCCC/N=C(\N)N[C@@H]1CC[C@@]2(c3ccc(OC)c(OC)c3)CCN(C)[C@@H]2C1 |
| InChI | InChI=1S/C22H36N4O2/c1-5-6-12-24-21(23)25-17-9-10-22(11-13-26(2)20(22)15-17)16-7-8-18(27-3)19(14-16)28-4/h7-8,14,17,20H,5-6,9-13,15H2,1-4H3,(H3,23,24,25)/t17-,20-,22+/m1/s1 |
| InChIKey | NBEOYMJCYVRDHK-ZNLUXHQJSA-N |
| XLogP | 2.90 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|