C25H33N3O2S2 — CID 11169239
1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(4-methylsulfanylphenyl)thiourea (PubChem CID 11169239) has the molecular formula C25H33N3O2S2 and a molecular weight of 471.69 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(4-methylsulfanylphenyl)thiourea.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(4-methylsulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 11169239 |
| Molecular Formula | C25H33N3O2S2 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(4-methylsulfanylphenyl)thiourea |
| SMILES | COc1ccc(C23CCC(NC(=S)Nc4ccc(SC)cc4)CC2N(C)CC3)cc1OC |
| InChI | InChI=1S/C25H33N3O2S2/c1-28-14-13-25(17-5-10-21(29-2)22(15-17)30-3)12-11-19(16-23(25)28)27-24(31)26-18-6-8-20(32-4)9-7-18/h5-10,15,19,23H,11-14,16H2,1-4H3,(H2,26,27,31) |
| InChIKey | BBGVNHRTMOMTMX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|