C28H30F9N3O4S — CID 87979876
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3,5-bis(trifluoromethyl)phenyl]thiourea;2,2,2-trifluoroacetic acid (PubChem CID 87979876) has the molecular formula C28H30F9N3O4S and a molecular weight of 675.61 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3,5-bis(trifluoromethyl)phenyl]thiourea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3,5-bis(trifluoromethyl)phenyl]thiourea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87979876 |
| Molecular Formula | C28H30F9N3O4S |
| Molecular Weight | 675.61 g/mol |
| Exact Mass | 675.18 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3,5-bis(trifluoromethyl)phenyl]thiourea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=S)Nc4cc(C(F)(F)F)cc(C(F)(F)F)c4)C[C@@H]2N(C)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H29F6N3O2S.C2HF3O2/c1-35-9-8-24(15-4-5-20(36-2)21(13-15)37-3)7-6-18(14-22(24)35)33-23(38)34-19-11-16(25(27,28)29)10-17(12-19)26(30,31)32;3-2(4,5)1(6)7/h4-5,10-13,18,22H,6-9,14H2,1-3H3,(H2,33,34,38);(H,6,7)/t18-,22+,24+;/m1./s1 |
| InChIKey | PTSJDDHXCNXXAX-CSCILALSSA-N |
| XLogP | 6.86 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.61 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|