C25H26F7N3O3 — CID 90884880
1-[(3aS,6R,7aR)-3a-[4-methoxy-3-(trifluoromethoxy)phenyl]-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 90884880) has the molecular formula C25H26F7N3O3 and a molecular weight of 549.49 g/mol. Its IUPAC name is 1-[(3aS,6R,7aR)-3a-[4-methoxy-3-(trifluoromethoxy)phenyl]-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3aS,6R,7aR)-3a-[4-methoxy-3-(trifluoromethoxy)phenyl]-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90884880 |
| Molecular Formula | C25H26F7N3O3 |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 1-[(3aS,6R,7aR)-3a-[4-methoxy-3-(trifluoromethoxy)phenyl]-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4cc(F)cc(C(F)(F)F)c4)C[C@H]2N(C)CC3)cc1OC(F)(F)F |
| InChI | InChI=1S/C25H26F7N3O3/c1-35-8-7-23(14-3-4-19(37-2)20(11-14)38-25(30,31)32)6-5-17(13-21(23)35)33-22(36)34-18-10-15(24(27,28)29)9-16(26)12-18/h3-4,9-12,17,21H,5-8,13H2,1-2H3,(H2,33,34,36)/t17-,21-,23+/m1/s1 |
| InChIKey | BGAPDEDLURVCAV-OAOOKAIFSA-N |
| XLogP | 6.07 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |