C24H29F2N3O3 — CID 11455759
1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,5-difluorophenyl)urea (PubChem CID 11455759) has the molecular formula C24H29F2N3O3 and a molecular weight of 445.51 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,5-difluorophenyl)urea.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 11455759 |
| Molecular Formula | C24H29F2N3O3 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,5-difluorophenyl)urea |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4cc(F)cc(F)c4)CC2N(C)CC3)cc1OC |
| InChI | InChI=1S/C24H29F2N3O3/c1-29-9-8-24(15-4-5-20(31-2)21(10-15)32-3)7-6-18(14-22(24)29)27-23(30)28-19-12-16(25)11-17(26)13-19/h4-5,10-13,18,22H,6-9,14H2,1-3H3,(H2,27,28,30) |
| InChIKey | XBLPGFCJGTURFS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |