C24H26F5N3O3 — CID 11273517
1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4,5,6-pentafluorophenyl)urea (PubChem CID 11273517) has the molecular formula C24H26F5N3O3 and a molecular weight of 499.48 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4,5,6-pentafluorophenyl)urea.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4,5,6-pentafluorophenyl)urea |
|---|---|
| PubChem CID | 11273517 |
| Molecular Formula | C24H26F5N3O3 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4,5,6-pentafluorophenyl)urea |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4c(F)c(F)c(F)c(F)c4F)CC2N(C)CC3)cc1OC |
| InChI | InChI=1S/C24H26F5N3O3/c1-32-9-8-24(12-4-5-14(34-2)15(10-12)35-3)7-6-13(11-16(24)32)30-23(33)31-22-20(28)18(26)17(25)19(27)21(22)29/h4-5,10,13,16H,6-9,11H2,1-3H3,(H2,30,31,33) |
| InChIKey | ICTXLQZLPCWYCE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|