C25H32FN3O3 — CID 91138765
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-fluoro-5-methylphenyl)urea (PubChem CID 91138765) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-fluoro-5-methylphenyl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-fluoro-5-methylphenyl)urea |
|---|---|
| PubChem CID | 91138765 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-fluoro-5-methylphenyl)urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4cc(C)ccc4F)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C25H32FN3O3/c1-16-5-7-19(26)20(13-16)28-24(30)27-18-9-10-25(11-12-29(2)23(25)15-18)17-6-8-21(31-3)22(14-17)32-4/h5-8,13-14,18,23H,9-12,15H2,1-4H3,(H2,27,28,30)/t18-,23+,25-/m0/s1 |
| InChIKey | TYPXCUPSCAXSEY-UODBTFMRSA-N |
| XLogP | 4.47 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |