C25H31Br2N3O3 — CID 91054361
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,5-dibromo-4-methylphenyl)urea (PubChem CID 91054361) has the molecular formula C25H31Br2N3O3 and a molecular weight of 581.35 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,5-dibromo-4-methylphenyl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,5-dibromo-4-methylphenyl)urea |
|---|---|
| PubChem CID | 91054361 |
| Molecular Formula | C25H31Br2N3O3 |
| Molecular Weight | 581.35 g/mol |
| Exact Mass | 579.07 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,5-dibromo-4-methylphenyl)urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4cc(Br)c(C)c(Br)c4)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C25H31Br2N3O3/c1-15-19(26)12-18(13-20(15)27)29-24(31)28-17-7-8-25(9-10-30(2)23(25)14-17)16-5-6-21(32-3)22(11-16)33-4/h5-6,11-13,17,23H,7-10,14H2,1-4H3,(H2,28,29,31)/t17-,23+,25-/m0/s1 |
| InChIKey | OSMPFMBNLWJZGA-YRSQORNKSA-N |
| XLogP | 5.85 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.35 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |