C24H32Cl2N4O4 — CID 87980650
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-chloro-6-methoxy-4-pyridinyl)urea;hydrochloride (PubChem CID 87980650) has the molecular formula C24H32Cl2N4O4 and a molecular weight of 511.45 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-chloro-6-methoxy-4-pyridinyl)urea;hydrochloride.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-chloro-6-methoxy-4-pyridinyl)urea;hydrochloride |
|---|---|
| PubChem CID | 87980650 |
| Molecular Formula | C24H32Cl2N4O4 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-chloro-6-methoxy-4-pyridinyl)urea;hydrochloride |
| SMILES | COc1cc(NC(=O)N[C@@H]2CC[C@@]3(c4ccc(OC)c(OC)c4)CCN(C)[C@H]3C2)cc(Cl)n1.Cl |
| InChI | InChI=1S/C24H31ClN4O4.ClH/c1-29-10-9-24(15-5-6-18(31-2)19(11-15)32-3)8-7-16(12-20(24)29)26-23(30)27-17-13-21(25)28-22(14-17)33-4;/h5-6,11,13-14,16,20H,7-10,12H2,1-4H3,(H2,26,27,28,30);1H/t16-,20+,24+;/m1./s1 |
| InChIKey | DRBOTSFULKPPQA-JUHVCRSZSA-N |
| XLogP | 4.50 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|