C26H32F3N3O5 — CID 11398329
1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-phenylurea;2,2,2-trifluoroacetic acid (PubChem CID 11398329) has the molecular formula C26H32F3N3O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-phenylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-phenylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11398329 |
| Molecular Formula | C26H32F3N3O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-phenylurea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccccc4)CC2N(C)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H31N3O3.C2HF3O2/c1-27-14-13-24(17-9-10-20(29-2)21(15-17)30-3)12-11-19(16-22(24)27)26-23(28)25-18-7-5-4-6-8-18;3-2(4,5)1(6)7/h4-10,15,19,22H,11-14,16H2,1-3H3,(H2,25,26,28);(H,6,7) |
| InChIKey | LHKKYVWFMBZYHK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |