C27H30F6N4O7 — CID 87981123
1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-nitro-3-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 87981123) has the molecular formula C27H30F6N4O7 and a molecular weight of 636.55 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-nitro-3-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-nitro-3-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87981123 |
| Molecular Formula | C27H30F6N4O7 |
| Molecular Weight | 636.55 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-nitro-3-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC2N(C)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H29F3N4O5.C2HF3O2/c1-31-11-10-24(15-4-7-20(36-2)21(12-15)37-3)9-8-17(14-22(24)31)30-23(33)29-16-5-6-19(32(34)35)18(13-16)25(26,27)28;3-2(4,5)1(6)7/h4-7,12-13,17,22H,8-11,14H2,1-3H3,(H2,29,30,33);(H,6,7) |
| InChIKey | VKTFNXGYEHSXFN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|