C25H32N4O6 — CID 91062006
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-methoxy-5-nitrophenyl)urea (PubChem CID 91062006) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-methoxy-5-nitrophenyl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-methoxy-5-nitrophenyl)urea |
|---|---|
| PubChem CID | 91062006 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-methoxy-5-nitrophenyl)urea |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)N[C@H]1CC[C@@]2(c3ccc(OC)c(OC)c3)CCN(C)[C@@H]2C1 |
| InChI | InChI=1S/C25H32N4O6/c1-28-12-11-25(16-5-7-21(34-3)22(13-16)35-4)10-9-17(14-23(25)28)26-24(30)27-19-15-18(29(31)32)6-8-20(19)33-2/h5-8,13,15,17,23H,9-12,14H2,1-4H3,(H2,26,27,30)/t17-,23+,25-/m0/s1 |
| InChIKey | CFYNCMARGDVXTB-YRSQORNKSA-N |
| XLogP | 3.94 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|