C24H30N4O5 — CID 91096851
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-nitrophenyl)urea (PubChem CID 91096851) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-nitrophenyl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-nitrophenyl)urea |
|---|---|
| PubChem CID | 91096851 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-nitrophenyl)urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4ccccc4[N+](=O)[O-])C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C24H30N4O5/c1-27-13-12-24(16-8-9-20(32-2)21(14-16)33-3)11-10-17(15-22(24)27)25-23(29)26-18-6-4-5-7-19(18)28(30)31/h4-9,14,17,22H,10-13,15H2,1-3H3,(H2,25,26,29)/t17-,22+,24-/m0/s1 |
| InChIKey | ZZRLGCOEHUVFRT-YJGRUCBDSA-N |
| XLogP | 3.93 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|