C25H29F4N3O3 — CID 90857514
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 90857514) has the molecular formula C25H29F4N3O3 and a molecular weight of 495.52 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90857514 |
| Molecular Formula | C25H29F4N3O3 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4cc(C(F)(F)F)ccc4F)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C25H29F4N3O3/c1-32-11-10-24(15-5-7-20(34-2)21(13-15)35-3)9-8-17(14-22(24)32)30-23(33)31-19-12-16(25(27,28)29)4-6-18(19)26/h4-7,12-13,17,22H,8-11,14H2,1-3H3,(H2,30,31,33)/t17-,22+,24-/m0/s1 |
| InChIKey | VSCGJHDBSQXBJM-YJGRUCBDSA-N |
| XLogP | 5.18 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |