C28H39N3O3 — CID 91437427
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(4-tert-butylphenyl)urea (PubChem CID 91437427) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 91437427 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(4-tert-butylphenyl)urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4ccc(C(C)(C)C)cc4)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C28H39N3O3/c1-27(2,3)19-7-10-21(11-8-19)29-26(32)30-22-13-14-28(15-16-31(4)25(28)18-22)20-9-12-23(33-5)24(17-20)34-6/h7-12,17,22,25H,13-16,18H2,1-6H3,(H2,29,30,32)/t22-,25+,28-/m0/s1 |
| InChIKey | GMBTYICISSIQGP-DLNIMUOOSA-N |
| XLogP | 5.32 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |