C27H34N4O3 — CID 91615435
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-methyl-1H-indol-5-yl)urea (PubChem CID 91615435) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-methyl-1H-indol-5-yl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-methyl-1H-indol-5-yl)urea |
|---|---|
| PubChem CID | 91615435 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-methyl-1H-indol-5-yl)urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4ccc5[nH]c(C)cc5c4)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C27H34N4O3/c1-17-13-18-14-20(6-7-22(18)28-17)29-26(32)30-21-9-10-27(11-12-31(2)25(27)16-21)19-5-8-23(33-3)24(15-19)34-4/h5-8,13-15,21,25,28H,9-12,16H2,1-4H3,(H2,29,30,32)/t21-,25+,27-/m0/s1 |
| InChIKey | HTYISRAPAKNXST-BBVXACFBSA-N |
| XLogP | 4.81 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |