C25H33N3O3S — CID 90768332
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 90768332) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 90768332 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4cccc(SC)c4)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C25H33N3O3S/c1-28-13-12-25(17-8-9-21(30-2)22(14-17)31-3)11-10-19(16-23(25)28)27-24(29)26-18-6-5-7-20(15-18)32-4/h5-9,14-15,19,23H,10-13,16H2,1-4H3,(H2,26,27,29)/t19-,23+,25-/m0/s1 |
| InChIKey | MAIUZXUIVHTSEC-CYSDGLOUSA-N |
| XLogP | 4.74 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |