C27H31F3N4O5 — CID 11455602
1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-cyanophenyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 11455602) has the molecular formula C27H31F3N4O5 and a molecular weight of 548.56 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-cyanophenyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-cyanophenyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11455602 |
| Molecular Formula | C27H31F3N4O5 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-cyanophenyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4cccc(C#N)c4)CC2N(C)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H30N4O3.C2HF3O2/c1-29-12-11-25(18-7-8-21(31-2)22(14-18)32-3)10-9-20(15-23(25)29)28-24(30)27-19-6-4-5-17(13-19)16-26;3-2(4,5)1(6)7/h4-8,13-14,20,23H,9-12,15H2,1-3H3,(H2,27,28,30);(H,6,7) |
| InChIKey | VWTCSJGPCYSAJL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |