C24H30BrN3O3 — CID 91348381
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-bromophenyl)urea (PubChem CID 91348381) has the molecular formula C24H30BrN3O3 and a molecular weight of 488.43 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-bromophenyl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-bromophenyl)urea |
|---|---|
| PubChem CID | 91348381 |
| Molecular Formula | C24H30BrN3O3 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3-bromophenyl)urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4cccc(Br)c4)C[C@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C24H30BrN3O3/c1-28-12-11-24(16-7-8-20(30-2)21(13-16)31-3)10-9-19(15-22(24)28)27-23(29)26-18-6-4-5-17(25)14-18/h4-8,13-14,19,22H,9-12,15H2,1-3H3,(H2,26,27,29)/t19-,22+,24-/m0/s1 |
| InChIKey | OSLORCOIVKXGAU-KWOQKUFVSA-N |
| XLogP | 4.78 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |