C28H33F4N3O3 — CID 90754159
1-[(3aS,6S,7aR)-1-cyclobutyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 90754159) has the molecular formula C28H33F4N3O3 and a molecular weight of 535.58 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-1-cyclobutyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3aS,6S,7aR)-1-cyclobutyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90754159 |
| Molecular Formula | C28H33F4N3O3 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 1-[(3aS,6S,7aR)-1-cyclobutyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4cc(F)cc(C(F)(F)F)c4)C[C@H]2N(C2CCC2)CC3)cc1OC |
| InChI | InChI=1S/C28H33F4N3O3/c1-37-23-7-6-17(14-24(23)38-2)27-9-8-20(16-25(27)35(11-10-27)22-4-3-5-22)33-26(36)34-21-13-18(28(30,31)32)12-19(29)15-21/h6-7,12-15,20,22,25H,3-5,8-11,16H2,1-2H3,(H2,33,34,36)/t20-,25+,27-/m0/s1 |
| InChIKey | VOZWINOBGRWTQD-FESMNKHTSA-N |
| XLogP | 6.10 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |