C31H37F6N3O5 — CID 87980934
1-[1-cyclohexyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 87980934) has the molecular formula C31H37F6N3O5 and a molecular weight of 645.64 g/mol. Its IUPAC name is 1-[1-cyclohexyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[1-cyclohexyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87980934 |
| Molecular Formula | C31H37F6N3O5 |
| Molecular Weight | 645.64 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | 1-[1-cyclohexyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccc(F)c(F)c4F)CC2N(C2CCCCC2)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H36F3N3O3.C2HF3O2/c1-37-23-11-8-18(16-24(23)38-2)29-13-12-19(17-25(29)35(15-14-29)20-6-4-3-5-7-20)33-28(36)34-22-10-9-21(30)26(31)27(22)32;3-2(4,5)1(6)7/h8-11,16,19-20,25H,3-7,12-15,17H2,1-2H3,(H2,33,34,36);(H,6,7) |
| InChIKey | VKFDCJUZWBITAR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|