C29H37F2N3O3 — CID 91399271
1-[(3aS,6S,7aR)-1-cyclohexyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea (PubChem CID 91399271) has the molecular formula C29H37F2N3O3 and a molecular weight of 513.63 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-1-cyclohexyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-1-cyclohexyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 91399271 |
| Molecular Formula | C29H37F2N3O3 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 1-[(3aS,6S,7aR)-1-cyclohexyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4ccc(F)c(F)c4)C[C@H]2N(C2CCCCC2)CC3)cc1OC |
| InChI | InChI=1S/C29H37F2N3O3/c1-36-25-11-8-19(16-26(25)37-2)29-13-12-21(33-28(35)32-20-9-10-23(30)24(31)17-20)18-27(29)34(15-14-29)22-6-4-3-5-7-22/h8-11,16-17,21-22,27H,3-7,12-15,18H2,1-2H3,(H2,32,33,35)/t21-,27+,29-/m0/s1 |
| InChIKey | AVWZHDHXJGZUIT-PEXXQYNDSA-N |
| XLogP | 6.00 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |