C29H32F2N4O3 — CID 91570241
1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-(pyridin-2-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea (PubChem CID 91570241) has the molecular formula C29H32F2N4O3 and a molecular weight of 522.60 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-(pyridin-2-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-(pyridin-2-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 91570241 |
| Molecular Formula | C29H32F2N4O3 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 1-[(3aS,6S,7aR)-3a-(3,4-dimethoxyphenyl)-1-(pyridin-2-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=O)Nc4ccc(F)c(F)c4)C[C@H]2N(Cc2ccccn2)CC3)cc1OC |
| InChI | InChI=1S/C29H32F2N4O3/c1-37-25-9-6-19(15-26(25)38-2)29-11-10-21(34-28(36)33-20-7-8-23(30)24(31)16-20)17-27(29)35(14-12-29)18-22-5-3-4-13-32-22/h3-9,13,15-16,21,27H,10-12,14,17-18H2,1-2H3,(H2,33,34,36)/t21-,27+,29-/m0/s1 |
| InChIKey | KVAZYEQYNDGHMI-PEXXQYNDSA-N |
| XLogP | 5.26 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |