C29H33F8N3O5 — CID 86601320
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3,3,3-trifluoro-2-methylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 86601320) has the molecular formula C29H33F8N3O5 and a molecular weight of 655.58 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3,3,3-trifluoro-2-methylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3,3,3-trifluoro-2-methylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86601320 |
| Molecular Formula | C29H33F8N3O5 |
| Molecular Weight | 655.58 g/mol |
| Exact Mass | 655.23 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3,3,3-trifluoro-2-methylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4ccc(F)c(F)c4)C[C@@H]2N(CC(C)C(F)(F)F)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H32F5N3O3.C2HF3O2/c1-16(27(30,31)32)15-35-11-10-26(17-4-7-22(37-2)23(12-17)38-3)9-8-19(14-24(26)35)34-25(36)33-18-5-6-20(28)21(29)13-18;3-2(4,5)1(6)7/h4-7,12-13,16,19,24H,8-11,14-15H2,1-3H3,(H2,33,34,36);(H,6,7)/t16?,19-,24+,26+;/m1./s1 |
| InChIKey | QNPFFNJGHYGAIJ-ABTLJURKSA-N |
| XLogP | 6.50 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |