C35H44F8N4O7 — CID 87978889
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3-piperidin-1-ylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87978889) has the molecular formula C35H44F8N4O7 and a molecular weight of 784.74 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3-piperidin-1-ylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3-piperidin-1-ylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87978889 |
| Molecular Formula | C35H44F8N4O7 |
| Molecular Weight | 784.74 g/mol |
| Exact Mass | 784.31 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3-piperidin-1-ylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4ccc(F)c(F)c4)C[C@@H]2N(CCCN2CCCCC2)CC3)cc1OC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H42F2N4O3.2C2HF3O2/c1-39-27-10-7-22(19-28(27)40-2)31-12-11-24(35-30(38)34-23-8-9-25(32)26(33)20-23)21-29(31)37(18-13-31)17-6-16-36-14-4-3-5-15-36;2*3-2(4,5)1(6)7/h7-10,19-20,24,29H,3-6,11-18,21H2,1-2H3,(H2,34,35,38);2*(H,6,7)/t24-,29+,31+;;/m1../s1 |
| InChIKey | AINRFUYVHLWFPK-WRAHKHKFSA-N |
| XLogP | 6.81 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.74 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |