C31H42F2N4O3 — CID 87978890
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3-piperidin-1-ylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea (PubChem CID 87978890) has the molecular formula C31H42F2N4O3 and a molecular weight of 556.70 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3-piperidin-1-ylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3-piperidin-1-ylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 87978890 |
| Molecular Formula | C31H42F2N4O3 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-(3-piperidin-1-ylpropyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4ccc(F)c(F)c4)C[C@@H]2N(CCCN2CCCCC2)CC3)cc1OC |
| InChI | InChI=1S/C31H42F2N4O3/c1-39-27-10-7-22(19-28(27)40-2)31-12-11-24(35-30(38)34-23-8-9-25(32)26(33)20-23)21-29(31)37(18-13-31)17-6-16-36-14-4-3-5-15-36/h7-10,19-20,24,29H,3-6,11-18,21H2,1-2H3,(H2,34,35,38)/t24-,29+,31+/m1/s1 |
| InChIKey | QODIYSMIWMBESD-AVKNQKEWSA-N |
| XLogP | 5.54 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |