C28H33F2N5O3 — CID 11262207
1-[3a-(3,4-dimethoxyphenyl)-1-[(2-methyl-1H-imidazol-5-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea (PubChem CID 11262207) has the molecular formula C28H33F2N5O3 and a molecular weight of 525.60 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-[(2-methyl-1H-imidazol-5-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-[(2-methyl-1H-imidazol-5-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 11262207 |
| Molecular Formula | C28H33F2N5O3 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-[(2-methyl-1H-imidazol-5-yl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccc(F)c(F)c4)CC2N(Cc2cnc(C)[nH]2)CC3)cc1OC |
| InChI | InChI=1S/C28H33F2N5O3/c1-17-31-15-21(32-17)16-35-11-10-28(18-4-7-24(37-2)25(12-18)38-3)9-8-20(14-26(28)35)34-27(36)33-19-5-6-22(29)23(30)13-19/h4-7,12-13,15,20,26H,8-11,14,16H2,1-3H3,(H,31,32)(H2,33,34,36) |
| InChIKey | ONMOVIGMIFTNCX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |