C34H44F8N4O7 — CID 87981117
1-[3a-(3,4-dimethoxyphenyl)-1-[3-(dimethylamino)-2,2-dimethylpropyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87981117) has the molecular formula C34H44F8N4O7 and a molecular weight of 772.73 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-[3-(dimethylamino)-2,2-dimethylpropyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-[3-(dimethylamino)-2,2-dimethylpropyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87981117 |
| Molecular Formula | C34H44F8N4O7 |
| Molecular Weight | 772.73 g/mol |
| Exact Mass | 772.31 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-[3-(dimethylamino)-2,2-dimethylpropyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccc(F)c(F)c4)CC2N(CC(C)(C)CN(C)C)CC3)cc1OC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H42F2N4O3.2C2HF3O2/c1-29(2,18-35(3)4)19-36-14-13-30(20-7-10-25(38-5)26(15-20)39-6)12-11-22(17-27(30)36)34-28(37)33-21-8-9-23(31)24(32)16-21;2*3-2(4,5)1(6)7/h7-10,15-16,22,27H,11-14,17-19H2,1-6H3,(H2,33,34,37);2*(H,6,7) |
| InChIKey | AIKUNQPWJAHBJF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.73 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |