C27H31F2N5O3 — CID 11479131
1-[3a-(3,4-dimethoxyphenyl)-1-(1H-imidazol-2-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea (PubChem CID 11479131) has the molecular formula C27H31F2N5O3 and a molecular weight of 511.57 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-(1H-imidazol-2-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-(1H-imidazol-2-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 11479131 |
| Molecular Formula | C27H31F2N5O3 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-(1H-imidazol-2-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccc(F)c(F)c4)CC2N(Cc2ncc[nH]2)CC3)cc1OC |
| InChI | InChI=1S/C27H31F2N5O3/c1-36-22-6-3-17(13-23(22)37-2)27-8-7-19(33-26(35)32-18-4-5-20(28)21(29)14-18)15-24(27)34(12-9-27)16-25-30-10-11-31-25/h3-6,10-11,13-14,19,24H,7-9,12,15-16H2,1-2H3,(H,30,31)(H2,32,33,35) |
| InChIKey | HCTLGZKQGFNLDY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |