C29H34ClF2N5O3 — CID 87979445
1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea (PubChem CID 87979445) has the molecular formula C29H34ClF2N5O3 and a molecular weight of 574.07 g/mol. Its IUPAC name is 1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 87979445 |
| Molecular Formula | C29H34ClF2N5O3 |
| Molecular Weight | 574.07 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 1-[1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(3,4-difluorophenyl)urea |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccc(F)c(F)c4)CC2N(Cc2c(C)nn(C)c2Cl)CC3)cc1OC |
| InChI | InChI=1S/C29H34ClF2N5O3/c1-17-21(27(30)36(2)35-17)16-37-12-11-29(18-5-8-24(39-3)25(13-18)40-4)10-9-20(15-26(29)37)34-28(38)33-19-6-7-22(31)23(32)14-19/h5-8,13-14,20,26H,9-12,15-16H2,1-4H3,(H2,33,34,38) |
| InChIKey | IIUPVCQWRRTNJZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.07 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |