C31H33Cl2F3N4O5 — CID 87979194
1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,6-dichloro-4-pyridinyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 87979194) has the molecular formula C31H33Cl2F3N4O5 and a molecular weight of 669.53 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,6-dichloro-4-pyridinyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,6-dichloro-4-pyridinyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87979194 |
| Molecular Formula | C31H33Cl2F3N4O5 |
| Molecular Weight | 669.53 g/mol |
| Exact Mass | 668.18 |
| IUPAC Name | 1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,6-dichloro-4-pyridinyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4cc(Cl)nc(Cl)c4)C[C@@H]2N(Cc2ccccc2)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H32Cl2N4O3.C2HF3O2/c1-37-23-9-8-20(14-24(23)38-2)29-11-10-21(32-28(36)33-22-16-26(30)34-27(31)17-22)15-25(29)35(13-12-29)18-19-6-4-3-5-7-19;3-2(4,5)1(6)7/h3-9,14,16-17,21,25H,10-13,15,18H2,1-2H3,(H2,32,33,34,36);(H,6,7)/t21-,25+,29+;/m1./s1 |
| InChIKey | CVUYUKKPQROZCT-VETIDAJRSA-N |
| XLogP | 6.93 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.53 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|