C29H39N3O2S — CID 91379519
1-[(3aS,6S,7aR)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-cyclopentylthiourea (PubChem CID 91379519) has the molecular formula C29H39N3O2S and a molecular weight of 493.72 g/mol. Its IUPAC name is 1-[(3aS,6S,7aR)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-cyclopentylthiourea.
| Compound Name | 1-[(3aS,6S,7aR)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-cyclopentylthiourea |
|---|---|
| PubChem CID | 91379519 |
| Molecular Formula | C29H39N3O2S |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 1-[(3aS,6S,7aR)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-cyclopentylthiourea |
| SMILES | COc1ccc([C@@]23CC[C@H](NC(=S)NC4CCCC4)C[C@H]2N(Cc2ccccc2)CC3)cc1OC |
| InChI | InChI=1S/C29H39N3O2S/c1-33-25-13-12-22(18-26(25)34-2)29-15-14-24(31-28(35)30-23-10-6-7-11-23)19-27(29)32(17-16-29)20-21-8-4-3-5-9-21/h3-5,8-9,12-13,18,23-24,27H,6-7,10-11,14-17,19-20H2,1-2H3,(H2,30,31,35)/t24-,27+,29-/m0/s1 |
| InChIKey | IIXMKVYCKVRUQV-HWUUJZMBSA-N |
| XLogP | 5.18 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|