C32H36F3N3O2S — CID 73101130
1-[3a-(3,4-dimethoxyphenyl)-1-[[3-(trifluoromethyl)phenyl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-benzylthiourea (PubChem CID 73101130) has the molecular formula C32H36F3N3O2S and a molecular weight of 583.72 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-[[3-(trifluoromethyl)phenyl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-benzylthiourea.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-[[3-(trifluoromethyl)phenyl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-benzylthiourea |
|---|---|
| PubChem CID | 73101130 |
| Molecular Formula | C32H36F3N3O2S |
| Molecular Weight | 583.72 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-[[3-(trifluoromethyl)phenyl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-benzylthiourea |
| SMILES | COc1ccc(C23CCC(NC(=S)NCc4ccccc4)CC2N(Cc2cccc(C(F)(F)F)c2)CC3)cc1OC |
| InChI | InChI=1S/C32H36F3N3O2S/c1-39-27-12-11-24(18-28(27)40-2)31-14-13-26(37-30(41)36-20-22-7-4-3-5-8-22)19-29(31)38(16-15-31)21-23-9-6-10-25(17-23)32(33,34)35/h3-12,17-18,26,29H,13-16,19-21H2,1-2H3,(H2,36,37,41) |
| InChIKey | AJXTVLRVQNINKO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|