C30H42N4O3S — CID 11467926
1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 11467926) has the molecular formula C30H42N4O3S and a molecular weight of 538.76 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 11467926 |
| Molecular Formula | C30H42N4O3S |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | 1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=S)NCCN4CCOCC4)C[C@@H]2N(Cc2ccccc2)CC3)cc1OC |
| InChI | InChI=1S/C30H42N4O3S/c1-35-26-9-8-24(20-27(26)36-2)30-11-10-25(32-29(38)31-13-15-33-16-18-37-19-17-33)21-28(30)34(14-12-30)22-23-6-4-3-5-7-23/h3-9,20,25,28H,10-19,21-22H2,1-2H3,(H2,31,32,38)/t25-,28+,30+/m1/s1 |
| InChIKey | NVGVUUOCGFCJOV-YRGIIOSFSA-N |
| XLogP | 3.56 |
| TPSA | 58.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|