C28H39N3O2S — CID 11273383
1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-butan-2-ylthiourea (PubChem CID 11273383) has the molecular formula C28H39N3O2S and a molecular weight of 481.71 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-butan-2-ylthiourea.
| Compound Name | 1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-butan-2-ylthiourea |
|---|---|
| PubChem CID | 11273383 |
| Molecular Formula | C28H39N3O2S |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 1-[(3aS,6R,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-butan-2-ylthiourea |
| SMILES | CCC(C)NC(=S)N[C@@H]1CC[C@@]2(c3ccc(OC)c(OC)c3)CCN(Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C28H39N3O2S/c1-5-20(2)29-27(34)30-23-13-14-28(22-11-12-24(32-3)25(17-22)33-4)15-16-31(26(28)18-23)19-21-9-7-6-8-10-21/h6-12,17,20,23,26H,5,13-16,18-19H2,1-4H3,(H2,29,30,34)/t20?,23-,26+,28+/m1/s1 |
| InChIKey | KPALUJYOEPPCQX-QMZOZJEYSA-N |
| XLogP | 5.03 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|