C32H40N4O2S — CID 11354319
1-[1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(dimethylamino)phenyl]thiourea (PubChem CID 11354319) has the molecular formula C32H40N4O2S and a molecular weight of 544.77 g/mol. Its IUPAC name is 1-[1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(dimethylamino)phenyl]thiourea.
| Compound Name | 1-[1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(dimethylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 11354319 |
| Molecular Formula | C32H40N4O2S |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 1-[1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[4-(dimethylamino)phenyl]thiourea |
| SMILES | COc1ccc(C23CCC(NC(=S)Nc4ccc(N(C)C)cc4)CC2N(Cc2ccccc2)CC3)cc1OC |
| InChI | InChI=1S/C32H40N4O2S/c1-35(2)27-13-11-25(12-14-27)33-31(39)34-26-16-17-32(24-10-15-28(37-3)29(20-24)38-4)18-19-36(30(32)21-26)22-23-8-6-5-7-9-23/h5-15,20,26,30H,16-19,21-22H2,1-4H3,(H2,33,34,39) |
| InChIKey | IXKCMPZRJLHAIQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|