C29H34N4O3S — CID 87979214
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(6-phenoxy-3-pyridinyl)thiourea (PubChem CID 87979214) has the molecular formula C29H34N4O3S and a molecular weight of 518.68 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(6-phenoxy-3-pyridinyl)thiourea.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(6-phenoxy-3-pyridinyl)thiourea |
|---|---|
| PubChem CID | 87979214 |
| Molecular Formula | C29H34N4O3S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(6-phenoxy-3-pyridinyl)thiourea |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=S)Nc4ccc(Oc5ccccc5)nc4)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C29H34N4O3S/c1-33-16-15-29(20-9-11-24(34-2)25(17-20)35-3)14-13-21(18-26(29)33)31-28(37)32-22-10-12-27(30-19-22)36-23-7-5-4-6-8-23/h4-12,17,19,21,26H,13-16,18H2,1-3H3,(H2,31,32,37)/t21-,26+,29+/m1/s1 |
| InChIKey | WVJOQPOGQLLJQJ-LVWCUCSXSA-N |
| XLogP | 5.37 |
| TPSA | 67.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|